For research use only. Not for therapeutic Use.
(4-Nitrophenyl)methanethiol(Cat No.:L006873), is a chemical compound used in various applications, including organic synthesis and chemical research. Its molecular structure consists of a 4-nitrophenyl group attached to a methanethiol moiety. This compound is employed as a versatile reagent in organic transformations, enabling the introduction of specific functional groups into molecules. Researchers utilize it in the synthesis of complex organic compounds, including pharmaceuticals and agrochemicals. The nitrophenyl group offers opportunities for diverse chemical modifications, making it valuable in the creation of specialized chemicals.
CAS Number | 26798-33-4 |
Molecular Formula | C7H7NO2S |
Purity | ≥95% |
IUPAC Name | (4-nitrophenyl)methanethiol |
InChI | InChI=1S/C7H7NO2S/c9-8(10)7-3-1-6(5-11)2-4-7/h1-4,11H,5H2 |
InChIKey | ACFHLWCEZHYYKX-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1CS)[N+](=O)[O-] |