For research use only. Not for therapeutic Use.
4-Nonyl Phenol-13C6 is a deuterated version of 4-nonylphenol, where six carbon atoms are replaced with the isotope 13C. This compound is employed as an internal standard in mass spectrometry and NMR spectroscopy to enhance the accuracy of quantification and structural analysis. In environmental chemistry, it is used to study the behavior and effects of 4-nonylphenol, a compound known for its endocrine-disrupting properties. In organic chemistry, it aids in reaction mechanism studies and isotope dilution analysis. Its stable isotope labeling ensures precise and reliable results in various analytical and research applications.
CAS Number | 211947-56-7 |
Synonyms | p-Nonylhenol-13C6; 4-Nonylphenol-13C6; 4-n-Nonyl Phenol-13C6; p-NP-13C6; p-Nonylphenol-13C6; p-n-Nonylphenol-13C6; |
Molecular Formula | C15H24O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-nonyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol |
InChI | InChI=1S/C15H24O/c1-2-3-4-5-6-7-8-9-14-10-12-15(16)13-11-14/h10-13,16H,2-9H2,1H3/i10+1,11+1,12+1,13+1,14+1,15+1 |
InChIKey | IGFHQQFPSIBGKE-RWFIAFQRSA-N |
SMILES | CCCCCCCCC[13C]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)O |