For research use only. Not for therapeutic Use.
4-Nonyl Phenol（Cat No.:R051192）is an organic compound used primarily as an intermediate in the production of surfactants, detergents, and other industrial chemicals. It consists of a phenol ring with a nonyl group attached at the 4-position, making it highly hydrophobic and effective in reducing surface tension in formulations. While it plays a significant role in manufacturing, 4-Nonyl Phenol is also known for its environmental persistence and potential endocrine-disrupting effects, leading to regulatory scrutiny. Its applications span various industries, including plastics, textiles, and agricultural chemicals.
| Catalog Number | R051192 |
| CAS Number | 104-40-5 |
| Synonyms | p-Nonylhenol; 4-Nonylphenol; 4-n-Nonyl Phenol; p-NP; p-Nonylphenol; p-n-Nonylphenol; |
| Molecular Formula | C15H24O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-nonylphenol |
| InChI | InChI=1S/C15H24O/c1-2-3-4-5-6-7-8-9-14-10-12-15(16)13-11-14/h10-13,16H,2-9H2,1H3 |
| InChIKey | IGFHQQFPSIBGKE-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC1=CC=C(C=C1)O |
