For research use only. Not for therapeutic Use.
4-O-β-Galactopyranosyl-D-mannopyranoside(Cat No.:R000894), also known as GM4, is a glycosphingolipid found in the membranes of cells, particularly in the nervous system. It consists of a β-galactopyranosyl residue linked to the 4-hydroxyl group of a D-mannopyranosyl residue. GM4 plays a role in cell recognition and signaling processes. It is involved in cell-cell interactions and is a precursor to more complex glycosphingolipids. GM4 has been studied for its potential involvement in neurological disorders and cancer.
CAS Number | 20869-27-6 |
Synonyms | Epilactose; 4-O-β-D-Galactopyranosyl-D-mannopyranose; |
Molecular Formula | C₁₂H₂₂O₁₁ |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[(2R,3S,4R,5S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol |
InChI | InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5+,6+,7-,8+,9-,10-,11?,12+/m1/s1 |
InChIKey | GUBGYTABKSRVRQ-GAQSDDIXSA-N |
SMILES | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O |