For research use only. Not for therapeutic Use.
4′-O-Methylbroussochalcone B(Cat No.:R035304)is a naturally occurring flavonoid compound found in various plant species, known for its potential biological activities. This methylated derivative of broussochalcone B exhibits antioxidant, anti-inflammatory, and antimicrobial properties. It has been investigated for its potential therapeutic effects in cancer, neurodegenerative diseases, and metabolic disorders. As a promising lead compound, 4′-O-Methylbroussochalcone B holds significant interest for pharmaceutical and biochemical research, particularly in the development of novel treatments targeting oxidative stress-related diseases. Its versatile biological effects make it a valuable candidate for further investigation.
CAS Number | 20784-60-5 |
Molecular Formula | C21H22O4 |
Purity | ≥95% |
Target | SARS-CoV |
IUPAC Name | (E)-1-[2-hydroxy-4-methoxy-5-(3-methylbut-2-enyl)phenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one |
InChI | InChI=1S/C21H22O4/c1-14(2)4-8-16-12-18(20(24)13-21(16)25-3)19(23)11-7-15-5-9-17(22)10-6-15/h4-7,9-13,22,24H,8H2,1-3H3/b11-7+ |
InChIKey | ZUGCRBMNFSAUOC-YRNVUSSQSA-N |
SMILES | CC(=CCC1=CC(=C(C=C1OC)O)C(=O)/C=C/C2=CC=C(C=C2)O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |