For research use only. Not for therapeutic Use.
4-O-Methylbutein(Cat No.:M056009) is a natural chemical compound classified as a flavonoid, specifically a chalcone derivative. It is characterized by a methoxy group attached to the fourth position of the button core. This structural modification enhances its biological properties, including antioxidant, anti-inflammatory, and potential anti-cancer activities. 4-O-Methylbutein is primarily found in certain plants and traditional herbs, contributing to their medicinal properties. It has been the subject of research studies aiming to explore its efficacy in preventing oxidative stress-related diseases and its mechanism of action in various cellular pathways.
CAS Number | 13323-67-6 |
Molecular Formula | C16H14O5 |
Purity | ≥95% |
Target | Plants |
Storage | Desiccate at +4C |
IUPAC Name | (E)-1-(2,4-dihydroxyphenyl)-3-(3-hydroxy-4-methoxyphenyl)prop-2-en-1-one |
InChI | InChI=1S/C16H14O5/c1-21-16-7-3-10(8-15(16)20)2-6-13(18)12-5-4-11(17)9-14(12)19/h2-9,17,19-20H,1H3/b6-2+ |
InChIKey | WGVFVBIJKULVHA-QHHAFSJGSA-N |
SMILES | COC1=C(C=C(C=C1)C=CC(=O)C2=C(C=C(C=C2)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |