For research use only. Not for therapeutic Use.
4-Octadecylphenol(Cat No.:L006835), is a chemical compound with a phenolic structure where an octadecyl (18-carbon) alkyl chain is attached to the phenol group. This compound finds applications as a surfactant, emulsifier, and stabilizer in various industries, including the production of rubber, plastics, and textiles. It acts as a processing aid and helps improve the physical properties of polymers. Additionally, 4-octadecylphenol is used as an intermediate in the synthesis of antioxidants, lubricants, and corrosion inhibitors.
CAS Number | 2589-79-9 |
Molecular Formula | C24H42O |
Purity | ≥95% |
IUPAC Name | 4-octadecylphenol |
InChI | InChI=1S/C24H42O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-19-21-24(25)22-20-23/h19-22,25H,2-18H2,1H3 |
InChIKey | QIZUBPHXHVWGHD-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCCCCCCCCC1=CC=C(C=C1)O |