For research use only. Not for therapeutic Use.
4-Oxo-3H-phthalazine-1-carboxylic acid is a heterocyclic compound used in pharmaceutical research and organic synthesis. Its structure, featuring a phthalazine ring with a carboxylic acid and an oxo group, makes it a valuable intermediate for developing bioactive molecules. It is often utilized in the synthesis of drugs, particularly those targeting central nervous system disorders and inflammatory conditions. Its versatile reactivity allows for chemical modifications, contributing to advancements in medicinal chemistry and the creation of novel therapeutic agents.
CAS Number | 3260-44-4 |
Molecular Formula | C9H6N2O3 |
Purity | ≥95% |
IUPAC Name | 4-oxo-3H-phthalazine-1-carboxylic acid |
InChI | InChI=1S/C9H6N2O3/c12-8-6-4-2-1-3-5(6)7(9(13)14)10-11-8/h1-4H,(H,11,12)(H,13,14) |
InChIKey | YHNOBCUFJJRVOP-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=NNC2=O)C(=O)O |