For research use only. Not for therapeutic Use.
4-Oxobutanoic Acid Methyl Ester（Cat No.:M056001）is a valuable intermediate in organic synthesis, widely used in the pharmaceutical and chemical industries. This compound, featuring a keto group and an ester function on a butanoic acid backbone, is highly reactive and versatile, making it an essential building block for the synthesis of complex molecular structures. It is commonly utilized in the development of active pharmaceutical ingredients (APIs) and fine chemicals. Its high purity and consistent reactivity are crucial for researchers and chemists working on innovative compound development and drug discovery projects.
| Catalog Number | M056001 |
| CAS Number | 13865-19-5 |
| Molecular Formula | C5H8O3 |
| Purity | ≥95% |
| IUPAC Name | methyl 4-oxobutanoate |
| InChI | InChI=1S/C5H8O3/c1-8-5(7)3-2-4-6/h4H,2-3H2,1H3 |
| InChIKey | DLZVZNAPRCRXEG-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC=O |
