For research use only. Not for therapeutic Use.
4-Oxodecanoic acid(CAT: L002475) is a ketone-substituted fatty acid with a 10-carbon chain, featuring a carbonyl (oxo) group at the 4-position. This compound is used in organic synthesis and biochemical research, often as an intermediate for producing complex lipids and other bioactive molecules. The presence of both a carboxylic acid group and a ketone group allows for further functionalization, making it useful in reactions such as esterification, amidation, and reduction. 4-Oxodecanoic acid is valued in studies related to lipid metabolism and biochemical pathway analysis, where it serves as a model compound or precursor for developing lipid-like structures with potential biological relevance, including studies in energy metabolism and enzyme activity.
CAS Number | 4144-54-1 |
Molecular Formula | C10H18O3 |
Purity | ≥95% |
IUPAC Name | 4-oxodecanoic acid |
InChI | InChI=1S/C10H18O3/c1-2-3-4-5-6-9(11)7-8-10(12)13/h2-8H2,1H3,(H,12,13) |
InChIKey | SPUWOYCLMKSXKU-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |