4-Oxopentanoic-13C3 Acid（Cat No.:R054610） is a high-purity, isotopically labeled compound essential for advanced biochemical and pharmaceutical research. Featuring three 13C atoms, this stable isotope-labeled version of 4-Oxopentanoic Acid is crucial for studies on metabolic pathways, enzyme reactions, and biochemical processes. 4-Oxopentanoic-13C3 Acid is a valuable tool for scientific investigations, aiding in drug development and enhancing the understanding of metabolic functions and biochemical mechanisms.
| Catalog Number | R054610 |
| CAS Number | 1391051-93-6 |
| Synonyms | 3-Acetylpropionic-13C3 Acid; 3-Oxobutanecarboxylic-13C3 Acid; 4-Ketovaleric-13C3 Acid; 4-Oxopentanoic-13C3 Acid; 4-Oxovaleric-13C3 Acid; Laevulinic-13C3 Acid; Levulic-13C3 Acid; NSC 3716-13C3; β-Acetylpropionic-13C3 Acid; γ-Ketovaleric-13C3 Acid; |
| Molecular Formula | C213C3H8O3 |
| Purity | ≥95% |
| Storage | Store at +4 ℃ |
| IUPAC Name | 4-oxo(3,4,5-13C3)pentanoic acid |
| InChI | InChI=1S/C5H8O3/c1-4(6)2-3-5(7)8/h2-3H2,1H3,(H,7,8)/i1+1,2+1,4+1 |
| InChIKey | JOOXCMJARBKPKM-STGVANJCSA-N |
| SMILES | [13CH3][13C](=O)[13CH2]CC(=O)O |
