For research use only. Not for therapeutic Use.
4′-(p-Tolyl)-2,2′:6′,2”-terpyridine(Cat No.:L036795)is a tridentate ligand commonly used in coordination chemistry and materials science. Its terpyridine core allows for strong binding to metal ions, making it valuable in the synthesis of metal complexes for catalysis, photophysical studies, and material applications. The p-tolyl group enhances its structural versatility and solubility, making it suitable for the development of advanced materials such as organic semiconductors and light-emitting diodes (OLEDs). This compound is also explored in supramolecular chemistry and the design of functional materials with potential applications in electronics and optoelectronics.
CAS Number | 89972-77-0 |
Molecular Formula | C22H17N3 |
Purity | ≥95% |
IUPAC Name | 4-(4-methylphenyl)-2,6-dipyridin-2-ylpyridine |
InChI | InChI=1S/C22H17N3/c1-16-8-10-17(11-9-16)18-14-21(19-6-2-4-12-23-19)25-22(15-18)20-7-3-5-13-24-20/h2-15H,1H3 |
InChIKey | IDJYBUVHZHLIIT-UHFFFAOYSA-N |
SMILES | CC1=CC=C(C=C1)C2=CC(=NC(=C2)C3=CC=CC=N3)C4=CC=CC=N4 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |