For research use only. Not for therapeutic Use.
4-Pentenoic Acid Ethyl Ester (Cat.No:R062950) is a chemical compound used in various applications. With its pentenoic acid structure and ethyl ester group, it serves as a versatile intermediate in organic synthesis. Its reactivity and functional groups make it valuable for creating diverse molecules in fields like pharmaceuticals, flavors, and fragrances.
CAS Number | 1968-40-7 |
Synonyms | 4-Ethoxycarbonylbut-1-ene; Ethyl 4-Pentenoate; Ethyl Pent-4-enoate |
Molecular Formula | C7H12O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | ethyl pent-4-enoate |
InChI | InChI=1S/C7H12O2/c1-3-5-6-7(8)9-4-2/h3H,1,4-6H2,2H3 |
InChIKey | PTVSRINJXWDIKP-UHFFFAOYSA-N |
SMILES | CCOC(=O)CCC=C |