For research use only. Not for therapeutic Use.
4-Phenethylaniline Hydrochloride（Cat No.:L042121）is a valuable chemical intermediate widely used in organic synthesis, particularly in the pharmaceutical and chemical industries. This compound features a phenethyl group attached to an aniline ring, with the hydrochloride form enhancing its stability and solubility. It is often employed in the synthesis of various active pharmaceutical ingredients (APIs) and fine chemicals, serving as a key building block for complex molecular structures. Its high purity and consistent reactivity make it essential for researchers and chemists involved in innovative compound development and drug discovery.
| Catalog Number | L042121 |
| CAS Number | 71845-20-0 |
| Molecular Formula | C14H16ClN |
| Purity | ≥95% |
| IUPAC Name | 4-(2-phenylethyl)aniline;hydrochloride |
| InChI | InChI=1S/C14H15N.ClH/c15-14-10-8-13(9-11-14)7-6-12-4-2-1-3-5-12;/h1-5,8-11H,6-7,15H2;1H |
| InChIKey | QJWSMOWGHWIWRZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC2=CC=C(C=C2)N.Cl |
