For research use only. Not for therapeutic Use.
4-(Phenethylcarbamoyl)phenylboronic acid(Cat No.:L006674), is a chemical compound used in organic synthesis and medicinal chemistry. Its structure includes a boronic acid group attached to a phenyl ring, which is further linked to a phenethylcarbamoyl group. This compound is essential in the development of pharmaceuticals, particularly in the field of cancer research, where boronic acids are utilized to create proteasome inhibitors. These inhibitors have potential applications in cancer therapy because they target specific proteins within cancer cells, making them valuable in drug discovery and development processes.
CAS Number | 330793-46-9 |
Molecular Formula | C15H16BNO3 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | [4-(2-phenylethylcarbamoyl)phenyl]boronic acid |
InChI | InChI=1S/C15H16BNO3/c18-15(13-6-8-14(9-7-13)16(19)20)17-11-10-12-4-2-1-3-5-12/h1-9,19-20H,10-11H2,(H,17,18) |
InChIKey | VTXXKSNJPIRHMK-UHFFFAOYSA-N |
SMILES | B(C1=CC=C(C=C1)C(=O)NCCC2=CC=CC=C2)(O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |