For research use only. Not for therapeutic Use.
4-Phenoxybenzylamine(Cat No.:M012528)is a high-purity chemical compound used in pharmaceutical and biochemical research. Featuring a phenoxy group attached to a benzylamine backbone, it serves as a versatile intermediate in the synthesis of various biologically active molecules. This compound is valuable in the development of drug candidates targeting receptor signaling, enzyme inhibition, and neurotransmitter regulation. 4-Phenoxybenzylamine is essential for the design of novel therapeutic agents, particularly in studies related to central nervous system disorders and cardiovascular diseases. Its chemical stability and adaptability make it suitable for diverse experimental applications in drug development.
CAS Number | 107622-80-0 |
Molecular Formula | C13H13NO |
Purity | ≥95% |
Target | HCV |
Storage | Store at RT |
IUPAC Name | (4-phenoxyphenyl)methanamine |
InChI | InChI=1S/C13H13NO/c14-10-11-6-8-13(9-7-11)15-12-4-2-1-3-5-12/h1-9H,10,14H2 |
InChIKey | CCAZAGUSBMVSAR-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)CN |