For research use only. Not for therapeutic Use.
4-Phenyl-3-butyn-2-one(Cat No.:M121286)is a versatile organic compound widely used in pharmaceutical and chemical research. This α,β-unsaturated ketone, featuring a phenyl group and an alkyne moiety, is a valuable building block in the synthesis of complex organic molecules, including those with potential therapeutic applications. Its unique structure allows for diverse chemical reactions, making it crucial in the development of various bioactive compounds. With its high purity and stability, 4-Phenyl-3-butyn-2-one supports precise synthetic transformations, offering reliable results in advanced medicinal chemistry and drug discovery projects.
Catalog Number | M121286 |
CAS Number | 1817-57-8 |
Molecular Formula | C10H8O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-phenylbut-3-yn-2-one |
InChI | InChI=1S/C10H8O/c1-9(11)7-8-10-5-3-2-4-6-10/h2-6H,1H3 |
InChIKey | UPEUQDJSUFHFQP-UHFFFAOYSA-N |
SMILES | CC(=O)C#CC1=CC=CC=C1 |