For research use only. Not for therapeutic Use.
4-Phenylbutyric acid (Cat No.:R048396), also known as Benzenebutyric acid, is a histone deacetylase (HDAC) inhibitor that plays a significant role in regulating hepatic hepcidin against HCV (Hepatitis C virus). By inhibiting HDAC, it modulates the acetylation of histones, leading to changes in gene expression and epigenetic regulation. Furthermore, 4-Phenylbutyric acid exhibits anti-inflammatory effects by modulating endoplasmic reticulum (ER) stress and autophagy in an acute lung injury model induced by LPS (lipopolysaccharide). Its diverse properties make it a potential candidate for various therapeutic applications, including hepatic and inflammatory conditions.
CAS Number | 1821-12-1 |
Synonyms | Benzenebutanoic Acid; 4-Phenyl-n-butyric Acid; γ-Phenylbutanoic Acid; NSC 295; |
Molecular Formula | C10H12O2 |
Purity | ≥95% |
Target | Epigenetics |
Storage | RT |
IUPAC Name | 4-phenylbutanoic acid |
InChI | InChI=1S/C10H12O2/c11-10(12)8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H,11,12) |
InChIKey | OBKXEAXTFZPCHS-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)CCCC(=O)O |