For research use only. Not for therapeutic Use.
4-Phenylpentanoic acid(Cat No.:L006744), is an organic compound represented by the molecular formula C12H14O2. It is a monocarboxylic acid with a phenyl group attached to the fourth carbon atom of the pentanoic acid chain. Also known as PPA, it is utilized in organic synthesis as a building block to create various pharmaceuticals, agrochemicals, and flavors. Its structure lends itself to diverse chemical reactions, making it valuable for the synthesis of complex molecules. Researchers leverage 4-phenyl pentanoic acid as a versatile tool in the development of biologically active compounds, aiding advancements in medicinal chemistry and related fields.
CAS Number | 16433-43-5 |
Molecular Formula | C11H14O2 |
Purity | ≥95% |
IUPAC Name | 4-phenylpentanoic acid |
InChI | InChI=1S/C11H14O2/c1-9(7-8-11(12)13)10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,12,13) |
InChIKey | UIIMQLPOAXFKFW-UHFFFAOYSA-N |
SMILES | CC(CCC(=O)O)C1=CC=CC=C1 |