Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> 4-(Piperidine-1-carbonyl)phenylboronic acid
For research use only. Not for therapeutic Use.
4-(Piperidine-1-carbonyl)phenylboronic acid (Cat.No:L030060) is a chemical compound utilized in organic synthesis. Its boronic acid group enables cross-coupling reactions, particularly Suzuki-Miyaura reactions, for building complex molecules. This compound is a valuable tool in medicinal chemistry and drug development due to its ability to create diverse molecular structures with potential pharmaceutical applications.
CAS Number | 389621-83-4 |
Molecular Formula | C12H16BNO3 |
Purity | ≥95% |
IUPAC Name | [4-(piperidine-1-carbonyl)phenyl]boronic acid |
InChI | InChI=1S/C12H16BNO3/c15-12(14-8-2-1-3-9-14)10-4-6-11(7-5-10)13(16)17/h4-7,16-17H,1-3,8-9H2 |
InChIKey | PUXUKRSBJVVKMD-UHFFFAOYSA-N |