For research use only. Not for therapeutic Use.
4-[(1-Oxopropyl)phenylamino]-4-piperidine carboxylic acid(Cat No.:M045115) is a complex organic molecule featuring a piperidine ring—a six-membered ring containing five carbon atoms and one nitrogen atom. The molecule is modified with a carboxylic acid group at the 4-position of the piperidine ring and a phenylamino substituent carrying a 1-oxopropyl group. This structure classifies it as an amino acid derivative with potential pharmacological activities. It is of interest in medicinal chemistry for the design and synthesis of novel therapeutic agents, particularly those targeting neurological pathways, due to the piperidine ring’s relevance in many bioactive compounds.
CAS Number | 186022-53-7 |
Molecular Formula | C23H28N2O3 |
Purity | ≥95% |
Documentation | |
Storage | -20°C |
IUPAC Name | 1-(2-phenylethyl)-4-(N-propanoylanilino)piperidine-4-carboxylic acid |
InChI | InChI=1S/C23H28N2O3/c1-2-21(26)25(20-11-7-4-8-12-20)23(22(27)28)14-17-24(18-15-23)16-13-19-9-5-3-6-10-19/h3-12H,2,13-18H2,1H3,(H,27,28) |
InChIKey | OMCWIVZSDHKRRQ-UHFFFAOYSA-N |
SMILES | CCC(=O)N(C1=CC=CC=C1)C2(CCN(CC2)CCC3=CC=CC=C3)C(=O)O |