For research use only. Not for therapeutic Use.
4-(Propan-2-yl)-1H-pyrrole-3-carboxylic acid(Cat No.:L007413), is a chemical compound represented by the molecular formula C10H13NO2. This compound falls within the class of pyrrole derivatives, containing a propane-2-yl group and a carboxylic acid functional group attached to the pyrrole ring. The specific applications and significance of this compound can vary widely. Researchers may study its chemical properties, reactivity, or biological activities to explore potential applications in fields such as medicinal chemistry, organic synthesis, or materials science.
CAS Number | 874496-74-9 |
Molecular Formula | C8H11NO2 |
Purity | ≥95% |
IUPAC Name | 4-propan-2-yl-1H-pyrrole-3-carboxylic acid |
InChI | InChI=1S/C8H11NO2/c1-5(2)6-3-9-4-7(6)8(10)11/h3-5,9H,1-2H3,(H,10,11) |
InChIKey | QCEFVFJIAIAKAD-UHFFFAOYSA-N |
SMILES | CC(C)C1=CNC=C1C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |