For research use only. Not for therapeutic Use.
4-(Propylsulfonyl)phenylboronic acid(CAT: M072977) is a high-purity organoboron compound featuring a phenyl ring substituted with a propylsulfonyl group and a boronic acid functionality. This structure makes it a versatile intermediate in pharmaceutical research, organic synthesis, and material science. The boronic acid group facilitates key cross-coupling reactions, such as Suzuki-Miyaura couplings, enabling the development of complex bioactive molecules, small-molecule inhibitors, and functionalized materials. The propylsulfonyl group enhances its utility for creating sulfonylated derivatives with improved chemical stability and biological activity. 4-(Propylsulfonyl)phenylboronic acid provides precision and reliability in both academic and industrial applications, supporting innovative pathways in medicinal chemistry and advanced materials development.
CAS Number | 1217501-34-2 |
Synonyms | 4-(Propylsulfonyl)phenylboronic acid |
Molecular Formula | C9H13BO4S |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | (4-propylsulfonylphenyl)boronic acid |
InChI | InChI=1S/C9H13BO4S/c1-2-7-15(13,14)9-5-3-8(4-6-9)10(11)12/h3-6,11-12H,2,7H2,1H3 |
InChIKey | JWRPDLRKXOTPJH-UHFFFAOYSA-N |
SMILES | B(C1=CC=C(C=C1)S(=O)(=O)CCC)(O)O |