Home
>
Chemical Reagents>Heterocyclic Building Blocks>
>
4-(pyridin-2-ylmethyl)aniline Dihydrochloride
For research use only. Not for therapeutic Use.
4-(pyridin-2-ylmethyl)aniline dihydrochloride(Cat No.:L006858), is a chemical compound used in medicinal chemistry and research. Its structure consists of an aniline group attached to a pyridin-2-ylmethyl moiety, and it exists in the dihydrochloride salt form, enhancing its stability and solubility. Researchers utilize this compound as a tool in biological studies and drug discovery efforts due to its potential biological activity. The dihydrochloride salt form improves its water solubility, making it suitable for biological assays.
Catalog Number | L006858 |
CAS Number | 96616-23-8 |
Molecular Formula | C12H14Cl2N2 |
Purity | ≥95% |
IUPAC Name | 4-(pyridin-2-ylmethyl)aniline;dihydrochloride |
InChI | InChI=1S/C12H12N2.2ClH/c13-11-6-4-10(5-7-11)9-12-3-1-2-8-14-12;;/h1-8H,9,13H2;2*1H |
InChIKey | ZWXAJYVBYLQVQA-UHFFFAOYSA-N |
SMILES | C1=CC=NC(=C1)CC2=CC=C(C=C2)N.Cl.Cl |