Home
>
Chemical Reagents>Heterocyclic Building Blocks> (4-(Pyridin-2-yl)phenyl)methanamine hydrochloride
For research use only. Not for therapeutic Use.
(4-(Pyridin-2-yl)phenyl)methanamine hydrochloride(Cat No.:L032033)is a heterocyclic compound featuring a pyridinyl-substituted phenyl ring and an amine group, with the hydrochloride salt form enhancing its solubility. This compound is commonly used in pharmaceutical research and organic synthesis as a building block for the development of biologically active molecules, including drug candidates. The amine group allows for versatile reactivity in coupling and functionalization reactions. Researchers in medicinal chemistry utilize this compound to create innovative therapeutic agents, making it valuable in drug discovery and chemical development efforts.
CAS Number | 1498333-87-1 |
Molecular Formula | C12H13ClN2 |
Purity | ≥95% |
IUPAC Name | (4-pyridin-2-ylphenyl)methanamine;hydrochloride |
InChI | InChI=1S/C12H12N2.ClH/c13-9-10-4-6-11(7-5-10)12-3-1-2-8-14-12;/h1-8H,9,13H2;1H |
InChIKey | CIJJNYGBSSBMHU-UHFFFAOYSA-N |
SMILES | C1=CC=NC(=C1)C2=CC=C(C=C2)CN.Cl |