For research use only. Not for therapeutic Use.
4-(Pyridin-4-yl)pyrimidine（Cat No.:L006769）. It consists of a pyridine ring and a pyrimidine ring, fused with the pyridinyl group attached at the 4-position of the pyrimidine ring. This compound is a heterocyclic aromatic molecule used in organic synthesis, specifically in medicinal chemistry and drug discovery. Its unique structure and potential for diverse chemical transformations make it valuable in the development of pharmaceuticals and biologically active compounds. Researchers utilize it as a building block to create novel molecules, contributing to advancements in drug design and the search for new therapeutic agents.
| Catalog Number | L006769 |
| CAS Number | 53345-78-1 |
| Molecular Formula | C9H7N3 |
| Purity | ≥95% |
| IUPAC Name | 4-pyridin-4-ylpyrimidine |
| InChI | InChI=1S/C9H7N3/c1-4-10-5-2-8(1)9-3-6-11-7-12-9/h1-7H |
| InChIKey | UACHOGFPFNIAIG-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=NC=NC=C2 |
