For research use only. Not for therapeutic Use.
4-Pyridinamine, 2-chloro-3-methoxy- (CAT: L000186) is a chemical compound with applications primarily in organic chemistry and potentially in pharmaceutical research. Its action mechanism involves its role as an intermediate in various chemical reactions, making it a valuable building block for the synthesis of complex organic molecules. In organic chemistry, this compound is significant for creating pharmaceutical intermediates and specialty chemicals. It holds potential importance in pharmaceutical research, where it can be used to design and synthesize novel therapeutic compounds.
CAS Number | 1227600-23-8 |
Molecular Formula | C6H7ClN2O |
Purity | ≥95% |
IUPAC Name | 2-chloro-3-methoxypyridin-4-amine |
InChI | InChI=1S/C6H7ClN2O/c1-10-5-4(8)2-3-9-6(5)7/h2-3H,1H3,(H2,8,9) |
InChIKey | OPZBNOCLLDRHQW-UHFFFAOYSA-N |