For research use only. Not for therapeutic Use.
2-Amino-4-pyrimidinecarboxaldehyde(Cat No.:M043360) is a derivative of pyrimidine, a heterocyclic aromatic organic compound similar to benzene and pyridine but containing nitrogen atoms. This specific compound features an amino group at the 2-position and a formyl group at the 4-position of the pyrimidine ring. It is primarily utilized in the field of pharmaceutical research and development due to its potential as a building block in the synthesis of more complex molecules, particularly nucleotide analogs and other biologically active compounds. Its functional groups make it a versatile intermediate for modifications, enabling the exploration of new drug therapies.
CAS Number | 165807-06-7 |
Molecular Formula | C5H5N3O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-aminopyrimidine-4-carbaldehyde |
InChI | InChI=1S/C5H5N3O/c6-5-7-2-1-4(3-9)8-5/h1-3H,(H2,6,7,8) |
InChIKey | JFGUYYUCZSRMCF-UHFFFAOYSA-N |
SMILES | C1=CN=C(N=C1C=O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |