Home
>
Chemical Reagents>Heterocyclic Building Blocks> 4-(Pyrrolidin-1-yl)-2-(trifluoromethyl)benzaldehyde
For research use only. Not for therapeutic Use.
4-(Pyrrolidin-1-yl)-2-(trifluoromethyl)benzaldehyde(Cat No.:L019319)is a significant intermediate in the synthesis of pharmaceutical compounds, particularly those targeting neurological and psychiatric disorders. The trifluoromethyl group enhances the compound’s lipophilicity and metabolic stability, while the pyrrolidine ring introduces potential interactions with biological targets. This benzaldehyde derivative is valuable for creating complex molecules in medicinal chemistry, aiding in the development of new therapeutic agents. Researchers utilize this high-purity compound to explore novel synthetic pathways and optimize the pharmacological properties of drug candidates in advanced research.
CAS Number | 886500-87-4 |
Molecular Formula | C12H12F3NO |
Purity | ≥95% |
IUPAC Name | 4-pyrrolidin-1-yl-2-(trifluoromethyl)benzaldehyde |
InChI | InChI=1S/C12H12F3NO/c13-12(14,15)11-7-10(4-3-9(11)8-17)16-5-1-2-6-16/h3-4,7-8H,1-2,5-6H2 |
InChIKey | UIPXFWNFCYGOKK-UHFFFAOYSA-N |
SMILES | C1CCN(C1)C2=CC(=C(C=C2)C=O)C(F)(F)F |