For research use only, not for therapeutic use.
4-(Pyrrolidin-2-yl)phenol hydrochloride(CAT: L000465) is a notable compound in the realm of pharmaceutical chemistry. It is used as an intermediate in the synthesis of various pharmaceutical compounds, particularly in the development of drugs. This compound plays a pivotal role in the creation of pharmaceutical intermediates, enabling the design and production of medications with potential therapeutic applications.
Catalog Number | L000465 |
CAS Number | 7167-72-8 |
Molecular Formula | C10H14ClNO |
Purity | ≥95% |
IUPAC Name | 4-pyrrolidin-2-ylphenol;hydrochloride |
InChI | InChI=1S/C10H13NO.ClH/c12-9-5-3-8(4-6-9)10-2-1-7-11-10;/h3-6,10-12H,1-2,7H2;1H |
InChIKey | YCBVEAPGKKFAPH-UHFFFAOYSA-N |