For research use only. Not for therapeutic Use.
4-(Rhamnosyloxy) phenyl acetonitrile(Cat No.:M016125) is a specialized organic compound that combines a phenyl acetonitrile moiety with a rhamnose sugar unit attached via an ether linkage at the 4-position. This structure features the nitrile group, which is reactive and useful in synthetic chemistry, particularly for further functional modifications. The rhamnose, a naturally occurring deoxy sugar, adds specific biochemical properties such as increasing water solubility and potentially interacting with biological systems that recognize sugar moieties. This compound is of interest in medicinal chemistry and biochemistry for its potential as a precursor in synthesizing targeted molecules for therapeutic applications.
CAS Number | 122001-32-5 |
Molecular Formula | C14H17NO5 |
Purity | ≥95% |
Target | Plants |
Storage | -20°C |
IUPAC Name | 2-[4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]acetonitrile |
InChI | InChI=1S/C14H17NO5/c1-8-11(16)12(17)13(18)14(19-8)20-10-4-2-9(3-5-10)6-7-15/h2-5,8,11-14,16-18H,6H2,1H3/t8-,11-,12+,13+,14-/m0/s1 |
InChIKey | OBJREHLZEIEGDU-CNJBRALLSA-N |
SMILES | CC1C(C(C(C(O1)OC2=CC=C(C=C2)CC#N)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |