For research use only. Not for therapeutic Use.
4-(sec-Butoxy)-4-oxobutanoic acid(Cat No.:L007252), is a chemical compound widely used in organic synthesis and medicinal chemistry research. Its molecular formula is C8H14O4. This compound features a ketone and a carboxylic acid functional group, providing reactivity for various transformations. Researchers utilize it as a key intermediate in the synthesis of complex organic molecules, including pharmaceuticals and agrochemicals. Its versatile reactivity allows for modifications, enabling the creation of novel compounds with tailored properties. The presence of the oxobutanoic acid moiety makes it valuable in drug discovery, contributing significantly to advancements in organic chemistry and the development of new therapeutic agents.
CAS Number | 100405-37-6 |
Molecular Formula | C8H14O4 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 4-butan-2-yloxy-4-oxobutanoic acid |
InChI | InChI=1S/C8H14O4/c1-3-6(2)12-8(11)5-4-7(9)10/h6H,3-5H2,1-2H3,(H,9,10) |
InChIKey | QXEKMBCCXWKAON-UHFFFAOYSA-N |
SMILES | CCC(C)OC(=O)CCC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |