For research use only. Not for therapeutic Use.
4-sec-Butylphenylboronic Acid Pinacol Ester(CAT: L013143) is a high-purity boronic ester widely used in pharmaceutical, chemical, and material science research. Featuring a sec-butyl-substituted phenyl group attached to a pinacol boronate ester, this compound is particularly valuable in Suzuki-Miyaura cross-coupling reactions for the synthesis of complex organic molecules, bioactive compounds, and advanced materials. Its unique structure makes it especially useful in medicinal chemistry for developing novel therapeutic agents and exploring structure-activity relationships. With excellent stability and reactivity, 4-sec-Butylphenylboronic Acid Pinacol Ester ensures precision and reliability, making it an essential tool for innovative research and advanced synthetic applications.
CAS Number | 1268242-41-6 |
Molecular Formula | C16H25BO2 |
Purity | ≥95% |
IUPAC Name | 2-(4-butan-2-ylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
InChI | InChI=1S/C16H25BO2/c1-7-12(2)13-8-10-14(11-9-13)17-18-15(3,4)16(5,6)19-17/h8-12H,7H2,1-6H3 |
InChIKey | KFJSDLRVUFZWGX-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(C)CC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |