Home
>
Reference Standards>ADC-linkers> 4-succinimidyloxycarbonyl-alpha-methyl-alpha(2-pyridyldithio)toluene
For research use only. Not for therapeutic Use.
4-succinimidyloxycarbonyl-alpha-methyl-alpha(2-pyridyldithio)toluene(CAT: M023072) is a chemical compound used in bioconjugation and protein modification. Its mode of action involves the reaction with amine groups in proteins to form stable amide bonds. This functionalization is commonly used in the preparation of various protein-based bioconjugates, such as antibodies and enzymes. The compound acts as a linker, enabling the attachment of biomolecules to surfaces or other molecules in research and biotechnological applications. Its unique chemical structure makes it a valuable tool in protein engineering, drug delivery systems, and diagnostics.
CAS Number | 112241-19-7 |
Synonyms | 4-succinimidyloxycarbonyl-alpha-methyl-alpha(2-pyridyldithio)toluene |
Molecular Formula | C18H16N2O4S2 |
Purity | ≥95% |
Target | ADC Linker |
Storage | -20°C |
IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[1-(pyridin-2-yldisulfanyl)ethyl]benzoate |
InChI | InChI=1S/C18H16N2O4S2/c1-12(25-26-15-4-2-3-11-19-15)13-5-7-14(8-6-13)18(23)24-20-16(21)9-10-17(20)22/h2-8,11-12H,9-10H2,1H3 |
InChIKey | GKSPIZSKQWTXQG-UHFFFAOYSA-N |
SMILES | CC(C1=CC=C(C=C1)C(=O)ON2C(=O)CCC2=O)SSC3=CC=CC=N3 |