Home
>
Chemical Reagents>Organometallic Reagents> (4-(((tert-Butoxycarbonyl)amino)methyl)-3-fluorophenyl)boronic acid
For research use only. Not for therapeutic Use.
(4-(((tert-Butoxycarbonyl)amino)methyl)-3-fluorophenyl)boronic acid (Cat.No:L004062) is a significant compound in medicinal chemistry. Its unique structure, incorporating a boronic acid and a fluoroaryl group, imparts distinctive reactivity. This compound is employed as a crucial reagent in the synthesis of specialized molecules with potential pharmaceutical activity.
Catalog Number | L004062 |
CAS Number | 1374451-80-5 |
Molecular Formula | C12H17BFNO4 |
Purity | ≥95% |
IUPAC Name | [3-fluoro-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]boronic acid |
InChI | InChI=1S/C12H17BFNO4/c1-12(2,3)19-11(16)15-7-8-4-5-9(13(17)18)6-10(8)14/h4-6,17-18H,7H2,1-3H3,(H,15,16) |
InChIKey | SAYNYRGHIRMQPN-UHFFFAOYSA-N |
SMILES | B(C1=CC(=C(C=C1)CNC(=O)OC(C)(C)C)F)(O)O |