For research use only. Not for therapeutic Use.
4-(Tert-Butyldimethylsilyloxy)cyclohexanone is a cyclic ketone with a tert-butyldimethylsilyloxy group (-Si(CH₃)₃O) attached to the 4-position of the cyclohexane ring. The silyl group enhances the compound’s stability and solubility, making it a useful protecting group in organic synthesis. This compound serves as an intermediate in the synthesis of various organic compounds, particularly in the preparation of complex molecules in pharmaceutical and material sciences. Its functionality allows for selective reactions and further chemical transformations in synthetic chemistry.
CAS Number | 55145-45-4 |
Molecular Formula | C12H24O2Si |
Purity | ≥95% |
IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxycyclohexan-1-one |
InChI | InChI=1S/C12H24O2Si/c1-12(2,3)15(4,5)14-11-8-6-10(13)7-9-11/h11H,6-9H2,1-5H3 |
InChIKey | HXKBGMNGSYGPRB-UHFFFAOYSA-N |
SMILES | CC(C)(C)[Si](C)(C)OC1CCC(=O)CC1 |