For research use only. Not for therapeutic Use.
4-Tetradecylphenol(Cat No.:L006761). It is a long-chain alkylphenol, specifically tetradecylphenol, where a phenolic group is attached to a tetradecyl (C14) hydrocarbon chain. This compound finds applications in various industrial processes, including as an intermediate in the production of surfactants, detergents, and emulsifiers. Its hydrophobic nature and surfactant properties make it useful in formulations for cleaning products, textile processing, and agricultural applications. Researchers also study its environmental impact due to its use and potential presence in wastewater, emphasizing the importance of proper handling and disposal.
CAS Number | 25401-89-2 |
Molecular Formula | C20H34O |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 4-tetradecylphenol |
InChI | InChI=1S/C20H34O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-19-15-17-20(21)18-16-19/h15-18,21H,2-14H2,1H3 |
InChIKey | PBFGGYXTTPKAHK-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCCCCC1=CC=C(C=C1)O |