For research use only. Not for therapeutic Use.
4-Thiothymidine(Cat No.:I041244)is a thymidine analog in which a sulfur atom replaces the oxygen atom at the 4-position of the thymine base. This modification alters its ability to interact with DNA, making it useful for studying DNA replication, repair, and mutagenesis. 4-Thiothymidine can be incorporated into growing DNA strands, where it can induce DNA damage or interfere with cellular processes such as nucleotide excision repair. It is used in research to explore mechanisms of DNA synthesis, mutations, and the development of new therapeutic strategies, especially in cancer and antiviral research.
CAS Number | 7236-57-9 |
Synonyms | 1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-4-sulfanylidenepyrimidin-2-one |
Molecular Formula | C10H14N2O4S |
Purity | ≥95% |
IUPAC Name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-4-sulfanylidenepyrimidin-2-one |
InChI | InChI=1S/C10H14N2O4S/c1-5-3-12(10(15)11-9(5)17)8-2-6(14)7(4-13)16-8/h3,6-8,13-14H,2,4H2,1H3,(H,11,15,17)/t6-,7+,8+/m0/s1 |
InChIKey | AVKSPBJBGGHUMW-XLPZGREQSA-N |
SMILES | CC1=CN(C(=O)NC1=S)[C@H]2C[C@@H]([C@H](O2)CO)O |