For research use only. Not for therapeutic Use.
4-Thiouracil（Cat No.:R065250）is a sulfur-containing derivative of uracil, commonly used in biochemical and pharmaceutical research. This heterocyclic compound plays a key role as an antithyroid agent, inhibiting the synthesis of thyroid hormones by interfering with iodine oxidation. 4-Thiouracil is also utilized as a research tool in nucleic acid studies, where it can be incorporated into RNA to study RNA-protein interactions and RNA stability. Its versatility makes it valuable in both medical research and molecular biology, particularly in understanding thyroid disorders and RNA-related processes.
| Catalog Number | R065250 |
| CAS Number | 591-28-6 |
| Synonyms | 2-hydroxy-4-Mercaptopyrimidine;NSC 43288;4-Thiopyrimidin-2-one;4-TU |
| Molecular Formula | C4H4N2OS |
| Purity | ≥95% |
| IUPAC Name | 4-sulfanylidene-1H-pyrimidin-2-one |
| InChI | InChI=1S/C4H4N2OS/c7-4-5-2-1-3(8)6-4/h1-2H,(H2,5,6,7,8) |
| InChIKey | OVONXEQGWXGFJD-UHFFFAOYSA-N |
| SMILES | C1=CNC(=O)NC1=S |
| Reference | 1.Miller, M.R.,Robinson, K.J.,Cleary, M.D., et al. TU-tagging: Cell type-specific RNA isolation from intact complex tissues. Nature Methods 6(6), 439-441 (2009). |
