For research use only. Not for therapeutic Use.
4-(Trifluoromethoxy)benzonitrile is a fluorinated aromatic compound featuring a trifluoromethoxy group and a benzonitrile core. This compound serves as a versatile intermediate in pharmaceutical and agrochemical research, aiding in the synthesis of biologically active molecules. Its electron-withdrawing trifluoromethoxy group enhances molecular stability and reactivity, making it valuable for constructing compounds with optimized pharmacokinetic properties. Frequently used in medicinal chemistry, this compound supports the development of drugs and specialty chemicals where enhanced stability and selective interactions are required
| Catalog Number | L041477 |
| CAS Number | 332-25-2 |
| Molecular Formula | C8H4F3NO |
| Purity | ≥95% |
| IUPAC Name | 4-(trifluoromethoxy)benzonitrile |
| InChI | InChI=1S/C8H4F3NO/c9-8(10,11)13-7-3-1-6(5-12)2-4-7/h1-4H |
| InChIKey | XWHIXOMWXCHJPP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)OC(F)(F)F |
