For research use only. Not for therapeutic Use.
4-(Trifluoromethyl)isoindoline(Cat No.:L043690)is a heterocyclic compound used in pharmaceutical research and organic synthesis. The molecule features an isoindoline ring with a trifluoromethyl group attached at the 4-position, which imparts unique electronic and steric properties. This compound is valuable as an intermediate in the synthesis of biologically active molecules, particularly in the development of pharmaceuticals. The trifluoromethyl group can enhance metabolic stability and bioavailability, making it a crucial building block for drug discovery. Researchers employ it for its reactivity and versatility in creating complex molecular structures.
CAS Number | 1086395-63-2 |
Molecular Formula | C9H8F3N |
Purity | ≥95% |
IUPAC Name | 4-(trifluoromethyl)-2,3-dihydro-1H-isoindole |
InChI | InChI=1S/C9H8F3N/c10-9(11,12)8-3-1-2-6-4-13-5-7(6)8/h1-3,13H,4-5H2 |
InChIKey | GEPUADVOHGHQBZ-UHFFFAOYSA-N |
SMILES | C1C2=C(CN1)C(=CC=C2)C(F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |