For research use only. Not for therapeutic Use.
4-(Trifluoromethylthio) benzene boronic acid(Cat No.:L006722), is an organoboron compound widely used in chemical synthesis, particularly in the field of medicinal chemistry. Its boronic acid group allows it to participate in Suzuki-Miyaura cross-coupling reactions, facilitating the formation of carbon-carbon bonds. The trifluoromethylthio substituent enhances its reactivity and influences its electronic properties, making it valuable for modifying complex molecules and creating diverse chemical entities. Researchers employ 4-(Trifluoromethylthio) benzene boronic acid to design and synthesize biologically active compounds, contributing significantly to the development of pharmaceuticals and aiding advancements in drug discovery and organic synthesis.
CAS Number | 947533-15-5 |
Molecular Formula | C7H6BF3O2S |
Purity | ≥95% |
IUPAC Name | [4-(trifluoromethylsulfanyl)phenyl]boronic acid |
InChI | InChI=1S/C7H6BF3O2S/c9-7(10,11)14-6-3-1-5(2-4-6)8(12)13/h1-4,12-13H |
InChIKey | LCTCJAHRVYNYTQ-UHFFFAOYSA-N |
SMILES | B(C1=CC=C(C=C1)SC(F)(F)F)(O)O |