For research use only. Not for therapeutic Use.
4-Vinyl anisole(Cat No.:R071003)is an aromatic compound featuring a vinyl group attached to the para position of an anisole (methoxybenzene) ring. This compound is widely used in polymer chemistry and organic synthesis. Its vinyl group allows it to undergo polymerization, making it a valuable monomer in producing specialty polymers and resins. The methoxy group enhances the compound’s reactivity, enabling it to participate in various chemical reactions. 4-Vinyl anisole is also utilized in synthesizing advanced materials, coatings, and fine chemicals, contributing to innovations in material science and industrial applications.
CAS Number | 637-69-4 |
Molecular Formula | C9H10O |
Purity | ≥95% |
IUPAC Name | 1-ethenyl-4-methoxybenzene |
InChI | InChI=1S/C9H10O/c1-3-8-4-6-9(10-2)7-5-8/h3-7H,1H2,2H3 |
InChIKey | UAJRSHJHFRVGMG-UHFFFAOYSA-N |
SMILES | COC1=CC=C(C=C1)C=C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |