For research use only. Not for therapeutic Use.
4-Vinylbenzaldehyde(Cat No.:M122224), is a chemical compound with the molecular formula C9H8O. It features a benzaldehyde backbone with a vinyl group (-CH=CH2) attached to the fourth carbon atom. This compound’s structure suggests its potential use in organic synthesis and as a building block for diverse compounds. The presence of the vinyl group on the aromatic ring can impact its reactivity, making it valuable for creating specialized molecules used in fragrances, flavors, and other fine chemicals.
CAS Number | 1791-26-0 |
Molecular Formula | C9H8O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-ethenylbenzaldehyde |
InChI | InChI=1S/C9H8O/c1-2-8-3-5-9(7-10)6-4-8/h2-7H,1H2 |
InChIKey | QBFNGLBSVFKILI-UHFFFAOYSA-N |
SMILES | C=CC1=CC=C(C=C1)C=O |