For research use only. Not for therapeutic Use.
4-Vinylbenzyl bromide is a chemical compound used in organic synthesis and polymerization reactions. This compound is a versatile building block for producing polymers and copolymers with vinyl functionalities. The addition of TBC as a stabilizer helps prevent unwanted side reactions, such as radical polymerization during storage. 4-Vinylbenzyl bromide is employed in the synthesis of specialty polymers, resins, and surface modifiers. Its reactivity and stability make it valuable in materials science and industrial applications, contributing to the development of advanced materials with tailored properties.
CAS Number | 13368-25-7 |
Synonyms | 1-(Bromomethyl)-4-ethenyl-benzene; p-(Bromomethyl)-styrene; 1-Bromomethyl-4-vinylbenzene; 4-(Bromomethyl)styrene; p-(Bromomethyl)styrene; p-Vinylbenzyl bromide |
Molecular Formula | C9H9Br |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-(bromomethyl)-4-ethenylbenzene |
InChI | InChI=1S/C9H9Br/c1-2-8-3-5-9(7-10)6-4-8/h2-6H,1,7H2 |
InChIKey | VTPQLJUADNBKRM-UHFFFAOYSA-N |
SMILES | C=CC1=CC=C(C=C1)CBr |