For research use only. Not for therapeutic Use.
4-Vinylbenzyl Chloride(Cat No.:M049329)is a versatile chemical compound featuring a vinyl group attached to a benzyl chloride structure. Widely used in polymer and material science, it serves as a key monomer for producing various copolymers and resins. Its reactive vinyl and chloromethyl groups enable easy polymerization and functionalization, making it ideal for creating specialty polymers with tailored properties. Applications include ion-exchange resins, adhesives, and coatings. 4-Vinylbenzyl Chloride is essential in the synthesis of advanced materials, offering enhanced performance in industrial and research settings.
CAS Number | 1592-20-7 |
Molecular Formula | C9H9Cl |
Purity | ≥95% |
Documentation | |
Storage | -20°C |
IUPAC Name | 1-(chloromethyl)-4-ethenylbenzene |
InChI | InChI=1S/C9H9Cl/c1-2-8-3-5-9(7-10)6-4-8/h2-6H,1,7H2 |
InChIKey | ZRZHXNCATOYMJH-UHFFFAOYSA-N |
SMILES | C=CC1=CC=C(C=C1)CCl |