For research use only. Not for therapeutic Use.
4,4′-Azobis(4-cyanovaleric acid) (Cat No.:R058439) is a chemical compound used primarily as a polymerization initiator due to its ability to decompose into free radicals at elevated temperatures. This azo compound contains cyano and carboxylic acid functional groups, enhancing its reactivity in various polymer systems. It is particularly valuable in the manufacturing of plastics and rubber, where it initiates the radical polymerization of monomers into polymers, thus playing a crucial role in the development of high-performance materials.
CAS Number | 2638-94-0 |
Synonyms | 4,4’-Azobis(4-cyanopentanecarboxylic Acid); 4,4’-Azobis(cyanovaleric Acid); 4,4’-Azobis[4-cyanopentanoic Acid]; 4,4’-Azobis[4-cyanovaleric Acid]; ABCPA; ABCVA; ACV-A; Azobis(cyanovaleric Acid); NC 25; NSC 114466; V 501; VA 501; Vazo 68; Vazo 68WSP; |
Molecular Formula | C12H16N4O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-[(4-carboxy-2-cyanobutan-2-yl)diazenyl]-4-cyanopentanoic acid |
InChI | InChI=1S/C12H16N4O4/c1-11(7-13,5-3-9(17)18)15-16-12(2,8-14)6-4-10(19)20/h3-6H2,1-2H3,(H,17,18)(H,19,20) |
InChIKey | VFXXTYGQYWRHJP-UHFFFAOYSA-N |
SMILES | CC(CCC(=O)O)(C#N)N=NC(C)(CCC(=O)O)C#N |