Home
>
Materials Science>Organic ligands for MOF materials> 4,4'-(1,10-Phenanthroline-3,8-diyl)dibenzoic acid
For research use only. Not for therapeutic Use.
4,4′-(1,10-Phenanthroline-3,8-diyl)dibenzoic acid is a complex organic compound consisting of a phenanthroline core linked to two benzoic acid groups. It is used primarily in coordination chemistry and materials science for the development of metal-organic frameworks (MOFs) and other supramolecular structures. The phenanthroline moiety acts as a ligand, coordinating with metal ions, while the benzoic acid groups provide additional binding sites, enhancing structural stability. This compound is valuable in research focused on catalysis, sensing, and advanced material design.
Catalog Number | L001098 |
CAS Number | 1659300-75-0 |
Molecular Formula | C26H16N2O4 |
Purity | ≥95% |
IUPAC Name | 4-[8-(4-carboxyphenyl)-1,10-phenanthrolin-3-yl]benzoic acid |
InChI | InChI=1S/C26H16N2O4/c29-25(30)17-5-1-15(2-6-17)21-11-19-9-10-20-12-22(14-28-24(20)23(19)27-13-21)16-3-7-18(8-4-16)26(31)32/h1-14H,(H,29,30)(H,31,32) |
InChIKey | RZPUEVQJLMTUFJ-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C2=CN=C3C(=C2)C=CC4=CC(=CN=C43)C5=CC=C(C=C5)C(=O)O)C(=O)O |