For research use only. Not for therapeutic Use.
4,4′-(2-Ethylhexylidene)diphenol(CAT: L030771), commonly referred to as Bisphenol Z (BPZ), is an organic compound featuring two phenol groups linked by a 2-ethylhexylidene bridge. This structure gives it similar properties to other bisphenols, making it useful in the production of polymers, resins, and plastics. BPZ is employed in manufacturing high-performance polycarbonates and epoxy resins, offering thermal stability and durability. Its branched alkyl group (ethylhexylidene) enhances the flexibility and solubility of the resulting materials, making it a valuable monomer in various industrial applications. Additionally, it can be used in coatings, adhesives, and other polymer-based products that require enhanced mechanical and chemical resistance.
CAS Number | 74462-02-5 |
Molecular Formula | C20H26O2 |
Purity | ≥95% |
IUPAC Name | 4-[2-ethyl-1-(4-hydroxyphenyl)hexyl]phenol |
InChI | InChI=1S/C20H26O2/c1-3-5-6-15(4-2)20(16-7-11-18(21)12-8-16)17-9-13-19(22)14-10-17/h7-15,20-22H,3-6H2,1-2H3 |
InChIKey | XXHIPRDUAVCXHW-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |