For research use only. Not for therapeutic Use.
4,4′-(2,2-Diphenylethene-1,1-diyl)diphenol (Cat.No:L004080) is a significant compound with diverse applications. Its distinctive structure, incorporating a diphenylethene backbone, imparts specialized properties. This compound finds use in the development of advanced materials, particularly in areas like optoelectronics and molecular electronics.
| Catalog Number | L004080 |
| CAS Number | 919789-77-8 |
| Molecular Formula | C26H20O2 |
| Purity | ≥95% |
| IUPAC Name | 4-[1-(4-hydroxyphenyl)-2,2-diphenylethenyl]phenol |
| InChI | InChI=1S/C26H20O2/c27-23-15-11-21(12-16-23)26(22-13-17-24(28)18-14-22)25(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-18,27-28H |
| InChIKey | OXBSSBYVVMIMMP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=C(C2=CC=C(C=C2)O)C3=CC=C(C=C3)O)C4=CC=CC=C4 |
